C23H38N6OS — CID 100778228
1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778228) has the molecular formula C23H38N6OS and a molecular weight of 446.67 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778228 |
| Molecular Formula | C23H38N6OS |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)NC[C@@H]3CCCO3)n2)C1 |
| InChI | InChI=1S/C23H38N6OS/c1-17-12-18(2)16-29(15-17)21-13-20(28-9-5-3-4-6-10-28)25-22(26-21)27-23(31)24-14-19-8-7-11-30-19/h13,17-19H,3-12,14-16H2,1-2H3,(H2,24,25,26,27,31)/t17-,18-,19+/m1/s1 |
| InChIKey | PWGYKLXRLMPZPO-QRVBRYPASA-N |
| XLogP | 3.80 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|