C18H28N6O2S — CID 100777951
1-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100777951) has the molecular formula C18H28N6O2S and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100777951 |
| Molecular Formula | C18H28N6O2S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)Nc1nc(N2CCCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H28N6O2S/c27-18(19-13-14-4-3-9-26-14)22-17-20-15(23-5-1-2-6-23)12-16(21-17)24-7-10-25-11-8-24/h12,14H,1-11,13H2,(H2,19,20,21,22,27)/t14-/m0/s1 |
| InChIKey | IHLRBQSPEYWWJF-AWEZNQCLSA-N |
| XLogP | 1.38 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|