C24H32N6OS — CID 100778265
1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778265) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778265 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)Nc1nc(N2CCCCCC2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C24H32N6OS/c32-24(25-15-20-10-7-13-31-20)28-23-26-21(29-11-5-1-2-6-12-29)14-22(27-23)30-16-18-8-3-4-9-19(18)17-30/h3-4,8-9,14,20H,1-2,5-7,10-13,15-17H2,(H2,25,26,27,28,32)/t20-/m0/s1 |
| InChIKey | FTTNPCVAPXQGII-FQEVSTJZSA-N |
| XLogP | 3.84 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|