C22H29N5O2S — CID 100778276
1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778276) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778276 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@H]1CCCO1)Nc1nc(Oc2ccccc2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C22H29N5O2S/c30-22(23-16-18-11-8-14-28-18)26-21-24-19(27-12-6-1-2-7-13-27)15-20(25-21)29-17-9-4-3-5-10-17/h3-5,9-10,15,18H,1-2,6-8,11-14,16H2,(H2,23,24,25,26,30)/t18-/m1/s1 |
| InChIKey | QNMLDSGWTVMSOX-GOSISDBHSA-N |
| XLogP | 4.11 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|