C22H36N6OS — CID 100778193
1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778193) has the molecular formula C22H36N6OS and a molecular weight of 432.64 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778193 |
| Molecular Formula | C22H36N6OS |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCCCC3)nc(NC(=S)NC[C@@H]3CCCO3)n2)C1 |
| InChI | InChI=1S/C22H36N6OS/c1-17-8-6-12-28(16-17)20-14-19(27-10-4-2-3-5-11-27)24-21(25-20)26-22(30)23-15-18-9-7-13-29-18/h14,17-18H,2-13,15-16H2,1H3,(H2,23,24,25,26,30)/t17-,18+/m1/s1 |
| InChIKey | KNFDWWOKITVKBF-MSOLQXFVSA-N |
| XLogP | 3.56 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|