C22H36N6OS — CID 125046325
1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 125046325) has the molecular formula C22H36N6OS and a molecular weight of 432.64 g/mol. Its IUPAC name is 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 125046325 |
| Molecular Formula | C22H36N6OS |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCC[C@@H](C)C3)nc(NC(=S)NC[C@H]3CCCO3)n2)CC1 |
| InChI | InChI=1S/C22H36N6OS/c1-16-7-10-27(11-8-16)19-13-20(28-9-3-5-17(2)15-28)25-21(24-19)26-22(30)23-14-18-6-4-12-29-18/h13,16-18H,3-12,14-15H2,1-2H3,(H2,23,24,25,26,30)/t17-,18-/m1/s1 |
| InChIKey | NVLZKTBTXISQMO-QZTJIDSGSA-N |
| XLogP | 3.41 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|