C26H37N7OS — CID 133254489
1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 133254489) has the molecular formula C26H37N7OS and a molecular weight of 495.70 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254489 |
| Molecular Formula | C26H37N7OS |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | CC1CCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCC3CCCO3)n2)CC1 |
| InChI | InChI=1S/C26H37N7OS/c1-20-9-11-32(12-10-20)23-18-24(33-15-13-31(14-16-33)21-6-3-2-4-7-21)29-25(28-23)30-26(35)27-19-22-8-5-17-34-22/h2-4,6-7,18,20,22H,5,8-17,19H2,1H3,(H2,27,28,29,30,35) |
| InChIKey | OIPFYXUSQNENIK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|