C20H27N7OS2 — CID 133254494
1-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 133254494) has the molecular formula C20H27N7OS2 and a molecular weight of 445.62 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254494 |
| Molecular Formula | C20H27N7OS2 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | CC1CCN(c2cc(Sc3ncccn3)nc(NC(=S)NCC3CCCO3)n2)CC1 |
| InChI | InChI=1S/C20H27N7OS2/c1-14-5-9-27(10-6-14)16-12-17(30-20-21-7-3-8-22-20)25-18(24-16)26-19(29)23-13-15-4-2-11-28-15/h3,7-8,12,14-15H,2,4-6,9-11,13H2,1H3,(H2,23,24,25,26,29) |
| InChIKey | WVGKIZSWFHTLFF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|