C15H19N7S2 — CID 100773928
1-ethyl-3-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100773928) has the molecular formula C15H19N7S2 and a molecular weight of 361.50 g/mol. Its IUPAC name is 1-ethyl-3-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-ethyl-3-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100773928 |
| Molecular Formula | C15H19N7S2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-ethyl-3-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | CCNC(=S)Nc1nc(Sc2ncccn2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H19N7S2/c1-2-16-14(23)21-13-19-11(22-8-3-4-9-22)10-12(20-13)24-15-17-6-5-7-18-15/h5-7,10H,2-4,8-9H2,1H3,(H2,16,19,20,21,23) |
| InChIKey | LDOXZSCUJHKMHJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|