C29H35N7OS — CID 133254512
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 133254512) has the molecular formula C29H35N7OS and a molecular weight of 529.71 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254512 |
| Molecular Formula | C29H35N7OS |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C29H35N7OS/c38-29(30-20-25-11-6-18-37-25)33-28-31-26(35-16-14-34(15-17-35)24-9-2-1-3-10-24)19-27(32-28)36-13-12-22-7-4-5-8-23(22)21-36/h1-5,7-10,19,25H,6,11-18,20-21H2,(H2,30,31,32,33,38) |
| InChIKey | AIHZKELGNHBFAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|