C18H20ClN5OS — CID 133254564
1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 133254564) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254564 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)Nc1nc(Cl)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C18H20ClN5OS/c19-15-8-16(24-10-12-4-1-2-5-13(12)11-24)22-17(21-15)23-18(26)20-9-14-6-3-7-25-14/h1-2,4-5,8,14H,3,6-7,9-11H2,(H2,20,21,22,23,26) |
| InChIKey | PDOQDYUEJPIENH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|