C22H21ClFN5S — CID 100786194
1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea (PubChem CID 100786194) has the molecular formula C22H21ClFN5S and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea.
| Compound Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100786194 |
| Molecular Formula | C22H21ClFN5S |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
| SMILES | Fc1ccc(CCCNC(=S)Nc2nc(Cl)cc(N3Cc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C22H21ClFN5S/c23-19-12-20(29-13-16-5-1-2-6-17(16)14-29)27-21(26-19)28-22(30)25-11-3-4-15-7-9-18(24)10-8-15/h1-2,5-10,12H,3-4,11,13-14H2,(H2,25,26,27,28,30) |
| InChIKey | IPBMJBXAEAVELK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|