C30H38FN7S — CID 100785987
1-[3-(4-fluorophenyl)propyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100785987) has the molecular formula C30H38FN7S and a molecular weight of 547.75 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)propyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100785987 |
| Molecular Formula | C30H38FN7S |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCCCc3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C30H38FN7S/c1-23-7-6-16-38(22-23)28-21-27(37-19-17-36(18-20-37)26-9-3-2-4-10-26)33-29(34-28)35-30(39)32-15-5-8-24-11-13-25(31)14-12-24/h2-4,9-14,21,23H,5-8,15-20,22H2,1H3,(H2,32,33,34,35,39)/t23-/m1/s1 |
| InChIKey | NSCAGVQAWGABML-HSZRJFAPSA-N |
| XLogP | 5.10 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|