C24H33N7S — CID 133252594
1-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 133252594) has the molecular formula C24H33N7S and a molecular weight of 451.64 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 133252594 |
| Molecular Formula | C24H33N7S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C24H33N7S/c1-3-11-25-24(32)28-23-26-21(17-22(27-23)31-12-7-8-19(2)18-31)30-15-13-29(14-16-30)20-9-5-4-6-10-20/h3-6,9-10,17,19H,1,7-8,11-16,18H2,2H3,(H2,25,26,27,28,32) |
| InChIKey | XUBYLMUJTYVMOU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|