C25H37N7OS — CID 100777289
1-(3-methoxypropyl)-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100777289) has the molecular formula C25H37N7OS and a molecular weight of 483.69 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100777289 |
| Molecular Formula | C25H37N7OS |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | COCCCNC(=S)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCC[C@@H](C)C2)n1 |
| InChI | InChI=1S/C25H37N7OS/c1-20-8-6-12-32(19-20)23-18-22(27-24(28-23)29-25(34)26-11-7-17-33-2)31-15-13-30(14-16-31)21-9-4-3-5-10-21/h3-5,9-10,18,20H,6-8,11-17,19H2,1-2H3,(H2,26,27,28,29,34)/t20-/m1/s1 |
| InChIKey | RSVSUSSLXQNWRG-HXUWFJFHSA-N |
| XLogP | 3.36 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|