C22H31N7OS — CID 100776765
1-(2-methoxyethyl)-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100776765) has the molecular formula C22H31N7OS and a molecular weight of 441.61 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100776765 |
| Molecular Formula | C22H31N7OS |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | COCCNC(=S)Nc1nc(N2CCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C22H31N7OS/c1-30-16-9-23-22(31)26-21-24-19(28-10-5-6-11-28)17-20(25-21)29-14-12-27(13-15-29)18-7-3-2-4-8-18/h2-4,7-8,17H,5-6,9-16H2,1H3,(H2,23,24,25,26,31) |
| InChIKey | JTXFTXDNBWCMDP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|