C20H27N7S — CID 100773218
1-methyl-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100773218) has the molecular formula C20H27N7S and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-methyl-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-methyl-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100773218 |
| Molecular Formula | C20H27N7S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-methyl-3-[4-(4-phenylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | CNC(=S)Nc1nc(N2CCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H27N7S/c1-21-20(28)24-19-22-17(26-9-5-6-10-26)15-18(23-19)27-13-11-25(12-14-27)16-7-3-2-4-8-16/h2-4,7-8,15H,5-6,9-14H2,1H3,(H2,21,22,23,24,28) |
| InChIKey | OOOXOWIQTWTUKX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|