C18H30N6S — CID 100773271
1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-methylthiourea (PubChem CID 100773271) has the molecular formula C18H30N6S and a molecular weight of 362.55 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-methylthiourea.
| Compound Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 100773271 |
| Molecular Formula | C18H30N6S |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1nc(N2CCCCC2)cc(N2C[C@H](C)C[C@H](C)C2)n1 |
| InChI | InChI=1S/C18H30N6S/c1-13-9-14(2)12-24(11-13)16-10-15(23-7-5-4-6-8-23)20-17(21-16)22-18(25)19-3/h10,13-14H,4-9,11-12H2,1-3H3,(H2,19,20,21,22,25)/t13-,14+ |
| InChIKey | SQYTXOXTOMCNAO-OKILXGFUSA-N |
| XLogP | 2.87 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|