C21H36N6S — CID 100775733
1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea (PubChem CID 100775733) has the molecular formula C21H36N6S and a molecular weight of 404.63 g/mol. Its IUPAC name is 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 100775733 |
| Molecular Formula | C21H36N6S |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1nc(N2CCCCC2)cc(N2C[C@H](C)C[C@H](C)C2)n1 |
| InChI | InChI=1S/C21H36N6S/c1-15(2)12-22-21(28)25-20-23-18(26-8-6-5-7-9-26)11-19(24-20)27-13-16(3)10-17(4)14-27/h11,15-17H,5-10,12-14H2,1-4H3,(H2,22,23,24,25,28)/t16-,17+ |
| InChIKey | WLIPIAGZDQYICQ-CALCHBBNSA-N |
| XLogP | 3.89 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|