C23H33N7S — CID 133260738
1-ethyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133260738) has the molecular formula C23H33N7S and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-ethyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-ethyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133260738 |
| Molecular Formula | C23H33N7S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-ethyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CCNC(=S)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCCCC2C)n1 |
| InChI | InChI=1S/C23H33N7S/c1-3-24-23(31)27-22-25-20(17-21(26-22)30-12-8-7-9-18(30)2)29-15-13-28(14-16-29)19-10-5-4-6-11-19/h4-6,10-11,17-18H,3,7-9,12-16H2,1-2H3,(H2,24,25,26,27,31) |
| InChIKey | PLYQRQRHRBOYOP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|