C17H21ClN6S — CID 100774446
1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-ethylthiourea (PubChem CID 100774446) has the molecular formula C17H21ClN6S and a molecular weight of 376.92 g/mol. Its IUPAC name is 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-ethylthiourea.
| Compound Name | 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 100774446 |
| Molecular Formula | C17H21ClN6S |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(Cl)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H21ClN6S/c1-2-19-17(25)22-16-20-14(18)12-15(21-16)24-10-8-23(9-11-24)13-6-4-3-5-7-13/h3-7,12H,2,8-11H2,1H3,(H2,19,20,21,22,25) |
| InChIKey | CCQYWKATHNUIKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|