C23H23ClN6O2S — CID 100791677
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100791677) has the molecular formula C23H23ClN6O2S and a molecular weight of 483.00 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791677 |
| Molecular Formula | C23H23ClN6O2S |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)Nc1nc(Cl)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H23ClN6O2S/c24-20-13-21(30-10-8-29(9-11-30)17-4-2-1-3-5-17)27-22(26-20)28-23(33)25-14-16-6-7-18-19(12-16)32-15-31-18/h1-7,12-13H,8-11,14-15H2,(H2,25,26,27,28,33) |
| InChIKey | DFUVTBBENAOPRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|