C27H31N7O3S — CID 100791497
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100791497) has the molecular formula C27H31N7O3S and a molecular weight of 533.66 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791497 |
| Molecular Formula | C27H31N7O3S |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)Nc1nc(N2CCOCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H31N7O3S/c38-27(28-18-20-6-7-22-23(16-20)37-19-36-22)31-26-29-24(17-25(30-26)34-12-14-35-15-13-34)33-10-8-32(9-11-33)21-4-2-1-3-5-21/h1-7,16-17H,8-15,18-19H2,(H2,28,29,30,31,38) |
| InChIKey | FUCDRGSFIAYOKT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|