C19H20F3N5O3S — CID 100791917
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100791917) has the molecular formula C19H20F3N5O3S and a molecular weight of 455.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791917 |
| Molecular Formula | C19H20F3N5O3S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCOCC2)nc(NC(=S)NCc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C19H20F3N5O3S/c20-19(21,22)15-10-16(27-3-5-28-6-4-27)25-17(24-15)26-18(31)23-11-12-1-2-13-14(9-12)30-8-7-29-13/h1-2,9-10H,3-8,11H2,(H2,23,24,25,26,31) |
| InChIKey | YTJJADCRNMQNGS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|