C14H20F3N5O2S — CID 100777427
1-(3-methoxypropyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100777427) has the molecular formula C14H20F3N5O2S and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100777427 |
| Molecular Formula | C14H20F3N5O2S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[4-morpholin-4-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | COCCCNC(=S)Nc1nc(N2CCOCC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N5O2S/c1-23-6-2-3-18-13(25)21-12-19-10(14(15,16)17)9-11(20-12)22-4-7-24-8-5-22/h9H,2-8H2,1H3,(H2,18,19,20,21,25) |
| InChIKey | ZVCUMDFGOQOSRO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|