C19H31N7O3S — CID 100777586
1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777586) has the molecular formula C19H31N7O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777586 |
| Molecular Formula | C19H31N7O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCOCC1)Nc1nc(N2CCOCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H31N7O3S/c30-19(20-1-2-24-3-9-27-10-4-24)23-18-21-16(25-5-11-28-12-6-25)15-17(22-18)26-7-13-29-14-8-26/h15H,1-14H2,(H2,20,21,22,23,30) |
| InChIKey | XCSJPAYVZGALOI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|