C22H37N7OS — CID 133254402
1-[4-(3,5-dimethylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 133254402) has the molecular formula C22H37N7OS and a molecular weight of 447.65 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 133254402 |
| Molecular Formula | C22H37N7OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC1CC(C)CN(c2cc(N3CCCC3)nc(NC(=S)NCCN3CCOCC3)n2)C1 |
| InChI | InChI=1S/C22H37N7OS/c1-17-13-18(2)16-29(15-17)20-14-19(28-6-3-4-7-28)24-21(25-20)26-22(31)23-5-8-27-9-11-30-12-10-27/h14,17-18H,3-13,15-16H2,1-2H3,(H2,23,24,25,26,31) |
| InChIKey | DDDIGSRHJDODHM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|