C22H37N7O2S — CID 100777604
1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777604) has the molecular formula C22H37N7O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777604 |
| Molecular Formula | C22H37N7O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NCCN3CCOCC3)n2)C1 |
| InChI | InChI=1S/C22H37N7O2S/c1-17-13-18(2)16-29(15-17)20-14-19(28-7-11-31-12-8-28)24-21(25-20)26-22(32)23-3-4-27-5-9-30-10-6-27/h14,17-18H,3-13,15-16H2,1-2H3,(H2,23,24,25,26,32)/t17-,18+ |
| InChIKey | DBMKRBAEBPVTGK-HDICACEKSA-N |
| XLogP | 1.41 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|