C21H35N7OS — CID 100777554
1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777554) has the molecular formula C21H35N7OS and a molecular weight of 433.63 g/mol. Its IUPAC name is 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777554 |
| Molecular Formula | C21H35N7OS |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCOCC1)Nc1nc(N2CCCCC2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C21H35N7OS/c30-21(22-7-12-26-13-15-29-16-14-26)25-20-23-18(27-8-3-1-4-9-27)17-19(24-20)28-10-5-2-6-11-28/h17H,1-16H2,(H2,22,23,24,25,30) |
| InChIKey | AFFBVMXQEBWDAJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|