C23H39N7OS — CID 100777637
1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777637) has the molecular formula C23H39N7OS and a molecular weight of 461.68 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777637 |
| Molecular Formula | C23H39N7OS |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC1CCN(c2cc(N3CCCC[C@@H]3C)nc(NC(=S)NCCN3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C23H39N7OS/c1-18-6-10-29(11-7-18)20-17-21(30-9-4-3-5-19(30)2)26-22(25-20)27-23(32)24-8-12-28-13-15-31-16-14-28/h17-19H,3-16H2,1-2H3,(H2,24,25,26,27,32)/t19-/m0/s1 |
| InChIKey | SBAOEYUGCIXCAW-IBGZPJMESA-N |
| XLogP | 2.71 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|