C24H41N7OS — CID 100777730
1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 100777730) has the molecular formula C24H41N7OS and a molecular weight of 475.71 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 100777730 |
| Molecular Formula | C24H41N7OS |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)NCCN3CCOCC3)n2)C1 |
| InChI | InChI=1S/C24H41N7OS/c1-19-15-20(2)18-31(17-19)22-16-21(30-8-5-3-4-6-9-30)26-23(27-22)28-24(33)25-7-10-29-11-13-32-14-12-29/h16,19-20H,3-15,17-18H2,1-2H3,(H2,25,26,27,28,33)/t19-,20-/m1/s1 |
| InChIKey | QNDODKRXXJEXMG-WOJBJXKFSA-N |
| XLogP | 2.96 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|