C19H32N6OS — CID 100774679
1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-propylthiourea (PubChem CID 100774679) has the molecular formula C19H32N6OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-propylthiourea.
| Compound Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-propylthiourea |
|---|---|
| PubChem CID | 100774679 |
| Molecular Formula | C19H32N6OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1nc(N2CCOCC2)cc(N2C[C@H](C)C[C@H](C)C2)n1 |
| InChI | InChI=1S/C19H32N6OS/c1-4-5-20-19(27)23-18-21-16(24-6-8-26-9-7-24)11-17(22-18)25-12-14(2)10-15(3)13-25/h11,14-15H,4-10,12-13H2,1-3H3,(H2,20,21,22,23,27)/t14-,15+ |
| InChIKey | SSJDRLRADWIONK-GASCZTMLSA-N |
| XLogP | 2.49 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|