C23H31ClN6OS — CID 100781528
1-[(4-chlorophenyl)methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100781528) has the molecular formula C23H31ClN6OS and a molecular weight of 475.06 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100781528 |
| Molecular Formula | C23H31ClN6OS |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NCc3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C23H31ClN6OS/c1-16-11-17(2)15-30(14-16)21-12-20(29-7-9-31-10-8-29)26-22(27-21)28-23(32)25-13-18-3-5-19(24)6-4-18/h3-6,12,16-17H,7-11,13-15H2,1-2H3,(H2,25,26,27,28,32)/t16-,17-/m0/s1 |
| InChIKey | SDVJDZIBBCIESH-IRXDYDNUSA-N |
| XLogP | 3.94 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|