C21H36N6OS — CID 100777262
1-(3-methoxypropyl)-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100777262) has the molecular formula C21H36N6OS and a molecular weight of 420.63 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100777262 |
| Molecular Formula | C21H36N6OS |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | COCCCNC(=S)Nc1nc(N2CCC(C)CC2)cc(N2CCCC[C@@H]2C)n1 |
| InChI | InChI=1S/C21H36N6OS/c1-16-8-12-26(13-9-16)18-15-19(27-11-5-4-7-17(27)2)24-20(23-18)25-21(29)22-10-6-14-28-3/h15-17H,4-14H2,1-3H3,(H2,22,23,24,25,29)/t17-/m0/s1 |
| InChIKey | SBGQGAMQYDQQBL-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|