C22H36N6S — CID 100790726
1-cyclopentyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100790726) has the molecular formula C22H36N6S and a molecular weight of 416.64 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790726 |
| Molecular Formula | C22H36N6S |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCCC[C@@H]3C)nc(NC(=S)NC3CCCC3)n2)CC1 |
| InChI | InChI=1S/C22H36N6S/c1-16-10-13-27(14-11-16)19-15-20(28-12-6-5-7-17(28)2)25-21(24-19)26-22(29)23-18-8-3-4-9-18/h15-18H,3-14H2,1-2H3,(H2,23,24,25,26,29)/t17-/m0/s1 |
| InChIKey | YZQQSKBFFVCKRC-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|