C21H36N6S — CID 133254306
1-tert-butyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133254306) has the molecular formula C21H36N6S and a molecular weight of 404.63 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133254306 |
| Molecular Formula | C21H36N6S |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-tert-butyl-3-[4-(2-methylpiperidin-1-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCCCC3C)nc(NC(=S)NC(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C21H36N6S/c1-15-9-12-26(13-10-15)17-14-18(27-11-7-6-8-16(27)2)23-19(22-17)24-20(28)25-21(3,4)5/h14-16H,6-13H2,1-5H3,(H2,22,23,24,25,28) |
| InChIKey | XQZHAQVZMNYISH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|