C23H38N6S — CID 125045755
1-cyclohexyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 125045755) has the molecular formula C23H38N6S and a molecular weight of 430.67 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125045755 |
| Molecular Formula | C23H38N6S |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 1-cyclohexyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCCC[C@H]3C)nc(NC(=S)NC3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H38N6S/c1-17-11-14-28(15-12-17)20-16-21(29-13-7-6-8-18(29)2)26-22(25-20)27-23(30)24-19-9-4-3-5-10-19/h16-19H,3-15H2,1-2H3,(H2,24,25,26,27,30)/t18-/m1/s1 |
| InChIKey | DWEYZYFIUPTIOW-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|