C20H32N6OS — CID 133180055
1-cyclopentyl-3-[4-(2-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 133180055) has the molecular formula C20H32N6OS and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-(2-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-(2-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133180055 |
| Molecular Formula | C20H32N6OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1-cyclopentyl-3-[4-(2-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | CC1CCCCN1c1cc(N2CCOCC2)nc(NC(=S)NC2CCCC2)n1 |
| InChI | InChI=1S/C20H32N6OS/c1-15-6-4-5-9-26(15)18-14-17(25-10-12-27-13-11-25)22-19(23-18)24-20(28)21-16-7-2-3-8-16/h14-16H,2-13H2,1H3,(H2,21,22,23,24,28) |
| InChIKey | SSFCFXCYXWQHBC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|