C23H30N6OS — CID 100790719
1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100790719) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790719 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(Nc1nc(N2CCOCC2)cc(N2CCc3ccccc3C2)n1)NC1CCCC1 |
| InChI | InChI=1S/C23H30N6OS/c31-23(24-19-7-3-4-8-19)27-22-25-20(28-11-13-30-14-12-28)15-21(26-22)29-10-9-17-5-1-2-6-18(17)16-29/h1-2,5-6,15,19H,3-4,7-14,16H2,(H2,24,25,26,27,31) |
| InChIKey | IQHOFMIBGLBFEB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|