C30H36N6S — CID 100791301
1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-cycloheptylthiourea (PubChem CID 100791301) has the molecular formula C30H36N6S and a molecular weight of 512.73 g/mol. Its IUPAC name is 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-cycloheptylthiourea.
| Compound Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-cycloheptylthiourea |
|---|---|
| PubChem CID | 100791301 |
| Molecular Formula | C30H36N6S |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-cycloheptylthiourea |
| SMILES | S=C(Nc1nc(N2CCc3ccccc3C2)cc(N2CCc3ccccc3C2)n1)NC1CCCCCC1 |
| InChI | InChI=1S/C30H36N6S/c37-30(31-26-13-3-1-2-4-14-26)34-29-32-27(35-17-15-22-9-5-7-11-24(22)20-35)19-28(33-29)36-18-16-23-10-6-8-12-25(23)21-36/h5-12,19,26H,1-4,13-18,20-21H2,(H2,31,32,33,34,37) |
| InChIKey | VJMXRJDJXQSOCB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|