C27H32N6S — CID 100776515
1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-tert-butylthiourea (PubChem CID 100776515) has the molecular formula C27H32N6S and a molecular weight of 472.66 g/mol. Its IUPAC name is 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-tert-butylthiourea.
| Compound Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 100776515 |
| Molecular Formula | C27H32N6S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)Nc1nc(N2CCc3ccccc3C2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C27H32N6S/c1-27(2,3)31-26(34)30-25-28-23(32-14-12-19-8-4-6-10-21(19)17-32)16-24(29-25)33-15-13-20-9-5-7-11-22(20)18-33/h4-11,16H,12-15,17-18H2,1-3H3,(H2,28,29,30,31,34) |
| InChIKey | DNUJUAUOHOACGC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|