C19H25N5S — CID 100776580
1-tert-butyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100776580) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100776580 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-tert-butyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCc3ccccc3C2)nc(NC(=S)NC(C)(C)C)n1 |
| InChI | InChI=1S/C19H25N5S/c1-13-11-16(21-17(20-13)22-18(25)23-19(2,3)4)24-10-9-14-7-5-6-8-15(14)12-24/h5-8,11H,9-10,12H2,1-4H3,(H2,20,21,22,23,25) |
| InChIKey | OVHHNSBKSKHDEQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|