C14H23N5OS — CID 100776557
1-tert-butyl-3-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)thiourea (PubChem CID 100776557) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-tert-butyl-3-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100776557 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-tert-butyl-3-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
| SMILES | Cc1cc(N2CCOCC2)nc(NC(=S)NC(C)(C)C)n1 |
| InChI | InChI=1S/C14H23N5OS/c1-10-9-11(19-5-7-20-8-6-19)16-12(15-10)17-13(21)18-14(2,3)4/h9H,5-8H2,1-4H3,(H2,15,16,17,18,21) |
| InChIKey | RAKAWRLFXSRGNL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|