C16H27N5S — CID 125048160
1-tert-butyl-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125048160) has the molecular formula C16H27N5S and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125048160 |
| Molecular Formula | C16H27N5S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-tert-butyl-3-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCCC[C@H]2C)nc(NC(=S)NC(C)(C)C)n1 |
| InChI | InChI=1S/C16H27N5S/c1-11-10-13(21-9-7-6-8-12(21)2)18-14(17-11)19-15(22)20-16(3,4)5/h10,12H,6-9H2,1-5H3,(H2,17,18,19,20,22)/t12-/m1/s1 |
| InChIKey | HJDVJDLFOLMHLS-GFCCVEGCSA-N |
| XLogP | 3.25 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|