C23H25N5S — CID 100783063
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea (PubChem CID 100783063) has the molecular formula C23H25N5S and a molecular weight of 403.56 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783063 |
| Molecular Formula | C23H25N5S |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(C)cc(N3CCc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C23H25N5S/c1-16-7-9-18(10-8-16)14-24-23(29)27-22-25-17(2)13-21(26-22)28-12-11-19-5-3-4-6-20(19)15-28/h3-10,13H,11-12,14-15H2,1-2H3,(H2,24,25,26,27,29) |
| InChIKey | HXPSBQACKBJHRB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|