C24H26N6S — CID 100773522
1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-methylthiourea (PubChem CID 100773522) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-methylthiourea.
| Compound Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 100773522 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1nc(N2CCc3ccccc3C2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C24H26N6S/c1-25-24(31)28-23-26-21(29-12-10-17-6-2-4-8-19(17)15-29)14-22(27-23)30-13-11-18-7-3-5-9-20(18)16-30/h2-9,14H,10-13,15-16H2,1H3,(H2,25,26,27,28,31) |
| InChIKey | ATJDDENSPNLPFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|