C27H38N6S — CID 100791244
1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100791244) has the molecular formula C27H38N6S and a molecular weight of 478.71 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791244 |
| Molecular Formula | C27H38N6S |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCc4ccccc4C3)nc(NC(=S)NC3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C27H38N6S/c1-20-12-15-32(16-13-20)24-18-25(33-17-14-21-8-6-7-9-22(21)19-33)30-26(29-24)31-27(34)28-23-10-4-2-3-5-11-23/h6-9,18,20,23H,2-5,10-17,19H2,1H3,(H2,28,29,30,31,34) |
| InChIKey | CLQIJRUGYILTQQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|