C25H34N6S — CID 100790728
1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100790728) has the molecular formula C25H34N6S and a molecular weight of 450.66 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790728 |
| Molecular Formula | C25H34N6S |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 1-cyclopentyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCc4ccccc4C3)nc(NC(=S)NC3CCCC3)n2)CC1 |
| InChI | InChI=1S/C25H34N6S/c1-18-10-13-30(14-11-18)22-16-23(31-15-12-19-6-2-3-7-20(19)17-31)28-24(27-22)29-25(32)26-21-8-4-5-9-21/h2-3,6-7,16,18,21H,4-5,8-15,17H2,1H3,(H2,26,27,28,29,32) |
| InChIKey | AKFZGNWSUPJGCL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|