C22H22ClN5OS — CID 100781418
1-[(4-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methoxypyrimidin-2-yl]thiourea (PubChem CID 100781418) has the molecular formula C22H22ClN5OS and a molecular weight of 439.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100781418 |
| Molecular Formula | C22H22ClN5OS |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methoxypyrimidin-2-yl]thiourea |
| SMILES | COc1cc(N2CCc3ccccc3C2)nc(NC(=S)NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H22ClN5OS/c1-29-20-12-19(28-11-10-16-4-2-3-5-17(16)14-28)25-21(26-20)27-22(30)24-13-15-6-8-18(23)9-7-15/h2-9,12H,10-11,13-14H2,1H3,(H2,24,25,26,27,30) |
| InChIKey | BGYUWWDWOLWISU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|