C27H24ClN5OS — CID 100782018
1-[(2-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 100782018) has the molecular formula C27H24ClN5OS and a molecular weight of 502.04 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100782018 |
| Molecular Formula | C27H24ClN5OS |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | S=C(NCc1ccccc1Cl)Nc1nc(Oc2ccccc2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C27H24ClN5OS/c28-23-13-7-6-9-20(23)17-29-27(35)32-26-30-24(16-25(31-26)34-22-11-2-1-3-12-22)33-15-14-19-8-4-5-10-21(19)18-33/h1-13,16H,14-15,17-18H2,(H2,29,30,31,32,35) |
| InChIKey | YKNYRZBQKKOEMP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|